C13H17NO3S2 — CID 78980348
4-(5-ethyl-4-methylthiophene-2-carbonyl)thiomorpholine-3-carboxylic acid (PubChem CID 78980348) has the molecular formula C13H17NO3S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is 4-(5-ethyl-4-methylthiophene-2-carbonyl)thiomorpholine-3-carboxylic acid.
| Compound Name | 4-(5-ethyl-4-methylthiophene-2-carbonyl)thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 78980348 |
| Molecular Formula | C13H17NO3S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 4-(5-ethyl-4-methylthiophene-2-carbonyl)thiomorpholine-3-carboxylic acid |
| SMILES | CCc1sc(C(=O)N2CCSCC2C(=O)O)cc1C |
| InChI | InChI=1S/C13H17NO3S2/c1-3-10-8(2)6-11(19-10)12(15)14-4-5-18-7-9(14)13(16)17/h6,9H,3-5,7H2,1-2H3,(H,16,17) |
| InChIKey | PDHHLLVOIDJLKY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |