C14H19NO4S — CID 115670080
methyl 4-(5-ethyl-4-methylthiophene-2-carbonyl)morpholine-3-carboxylate (PubChem CID 115670080) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is methyl 4-(5-ethyl-4-methylthiophene-2-carbonyl)morpholine-3-carboxylate.
| Compound Name | methyl 4-(5-ethyl-4-methylthiophene-2-carbonyl)morpholine-3-carboxylate |
|---|---|
| PubChem CID | 115670080 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | methyl 4-(5-ethyl-4-methylthiophene-2-carbonyl)morpholine-3-carboxylate |
| SMILES | CCc1sc(C(=O)N2CCOCC2C(=O)OC)cc1C |
| InChI | InChI=1S/C14H19NO4S/c1-4-11-9(2)7-12(20-11)13(16)15-5-6-19-8-10(15)14(17)18-3/h7,10H,4-6,8H2,1-3H3 |
| InChIKey | MCFSWEAVATVSCT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |