C12H22N4O4 — CID 78982381
methyl 3-[4-[2-(methylcarbamoylamino)-2-oxoethyl]piperazin-1-yl]propanoate (PubChem CID 78982381) has the molecular formula C12H22N4O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is methyl 3-[4-[2-(methylcarbamoylamino)-2-oxoethyl]piperazin-1-yl]propanoate.
| Compound Name | methyl 3-[4-[2-(methylcarbamoylamino)-2-oxoethyl]piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 78982381 |
| Molecular Formula | C12H22N4O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | methyl 3-[4-[2-(methylcarbamoylamino)-2-oxoethyl]piperazin-1-yl]propanoate |
| SMILES | CNC(=O)NC(=O)CN1CCN(CCC(=O)OC)CC1 |
| InChI | InChI=1S/C12H22N4O4/c1-13-12(19)14-10(17)9-16-7-5-15(6-8-16)4-3-11(18)20-2/h3-9H2,1-2H3,(H2,13,14,17,19) |
| InChIKey | HRQJNINXFCZQLY-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |