C14H16N4 — CID 78988868
2-N-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrazine-2,6-diamine (PubChem CID 78988868) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is 2-N-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrazine-2,6-diamine.
| Compound Name | 2-N-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrazine-2,6-diamine |
|---|---|
| PubChem CID | 78988868 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 2-N-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrazine-2,6-diamine |
| SMILES | Nc1cncc(NC2CCc3ccccc3C2)n1 |
| InChI | InChI=1S/C14H16N4/c15-13-8-16-9-14(18-13)17-12-6-5-10-3-1-2-4-11(10)7-12/h1-4,8-9,12H,5-7H2,(H3,15,17,18) |
| InChIKey | ITBTUQKKFDNIJE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |