C8H12N4O — CID 80714757
2-N-(oxolan-3-yl)pyrazine-2,6-diamine (PubChem CID 80714757) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-N-(oxolan-3-yl)pyrazine-2,6-diamine.
| Compound Name | 2-N-(oxolan-3-yl)pyrazine-2,6-diamine |
|---|---|
| PubChem CID | 80714757 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 2-N-(oxolan-3-yl)pyrazine-2,6-diamine |
| SMILES | Nc1cncc(NC2CCOC2)n1 |
| InChI | InChI=1S/C8H12N4O/c9-7-3-10-4-8(12-7)11-6-1-2-13-5-6/h3-4,6H,1-2,5H2,(H3,9,11,12) |
| InChIKey | KGVBIRFJMWTWSY-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |