C9H13N3O — CID 80717720
4-N-(oxolan-3-yl)pyridine-3,4-diamine (PubChem CID 80717720) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is 4-N-(oxolan-3-yl)pyridine-3,4-diamine.
| Compound Name | 4-N-(oxolan-3-yl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 80717720 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 4-N-(oxolan-3-yl)pyridine-3,4-diamine |
| SMILES | Nc1cnccc1NC1CCOC1 |
| InChI | InChI=1S/C9H13N3O/c10-8-5-11-3-1-9(8)12-7-2-4-13-6-7/h1,3,5,7H,2,4,6,10H2,(H,11,12) |
| InChIKey | BAMXNRAERZPYLD-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |