C13H14BrClN2O3 — CID 78990925
(5-bromo-2-chloro-3-pyridinyl)-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)methanone (PubChem CID 78990925) has the molecular formula C13H14BrClN2O3 and a molecular weight of 361.62 g/mol. Its IUPAC name is (5-bromo-2-chloro-3-pyridinyl)-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)methanone.
| Compound Name | (5-bromo-2-chloro-3-pyridinyl)-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)methanone |
|---|---|
| PubChem CID | 78990925 |
| Molecular Formula | C13H14BrClN2O3 |
| Molecular Weight | 361.62 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | (5-bromo-2-chloro-3-pyridinyl)-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)methanone |
| SMILES | O=C(c1cc(Br)cnc1Cl)N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C13H14BrClN2O3/c14-9-7-10(11(15)16-8-9)12(18)17-3-1-13(2-4-17)19-5-6-20-13/h7-8H,1-6H2 |
| InChIKey | BGUMCJNKBPAEJD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.62 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|