C19H21ClN2O3 — CID 110299051
(2-chloro-6,8-dimethylquinolin-3-yl)-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)methanone (PubChem CID 110299051) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is (2-chloro-6,8-dimethylquinolin-3-yl)-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)methanone.
| Compound Name | (2-chloro-6,8-dimethylquinolin-3-yl)-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)methanone |
|---|---|
| PubChem CID | 110299051 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (2-chloro-6,8-dimethylquinolin-3-yl)-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)methanone |
| SMILES | Cc1cc(C)c2nc(Cl)c(C(=O)N3CCC4(CC3)OCCO4)cc2c1 |
| InChI | InChI=1S/C19H21ClN2O3/c1-12-9-13(2)16-14(10-12)11-15(17(20)21-16)18(23)22-5-3-19(4-6-22)24-7-8-25-19/h9-11H,3-8H2,1-2H3 |
| InChIKey | LEZDBAZXFWSFFZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|