C18H21ClN2O2 — CID 110309956
(2-chloro-6,8-dimethylquinolin-3-yl)-(3,5-dimethylmorpholin-4-yl)methanone (PubChem CID 110309956) has the molecular formula C18H21ClN2O2 and a molecular weight of 332.83 g/mol. Its IUPAC name is (2-chloro-6,8-dimethylquinolin-3-yl)-(3,5-dimethylmorpholin-4-yl)methanone.
| Compound Name | (2-chloro-6,8-dimethylquinolin-3-yl)-(3,5-dimethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 110309956 |
| Molecular Formula | C18H21ClN2O2 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (2-chloro-6,8-dimethylquinolin-3-yl)-(3,5-dimethylmorpholin-4-yl)methanone |
| SMILES | Cc1cc(C)c2nc(Cl)c(C(=O)N3C(C)COCC3C)cc2c1 |
| InChI | InChI=1S/C18H21ClN2O2/c1-10-5-11(2)16-14(6-10)7-15(17(19)20-16)18(22)21-12(3)8-23-9-13(21)4/h5-7,12-13H,8-9H2,1-4H3 |
| InChIKey | QZKZSMCPDFVCRG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|