C15H25NOS — CID 78993247
N-(2-methoxyethyl)-N-(2-phenylsulfanylethyl)butan-2-amine (PubChem CID 78993247) has the molecular formula C15H25NOS and a molecular weight of 267.44 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-(2-phenylsulfanylethyl)butan-2-amine.
| Compound Name | N-(2-methoxyethyl)-N-(2-phenylsulfanylethyl)butan-2-amine |
|---|---|
| PubChem CID | 78993247 |
| Molecular Formula | C15H25NOS |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | N-(2-methoxyethyl)-N-(2-phenylsulfanylethyl)butan-2-amine |
| SMILES | CCC(C)N(CCOC)CCSc1ccccc1 |
| InChI | InChI=1S/C15H25NOS/c1-4-14(2)16(10-12-17-3)11-13-18-15-8-6-5-7-9-15/h5-9,14H,4,10-13H2,1-3H3 |
| InChIKey | DFOANHFCZQFTDV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |