C10H16N2O — CID 78994718
N-butan-2-yl-1-cyanocyclobutane-1-carboxamide (PubChem CID 78994718) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is N-butan-2-yl-1-cyanocyclobutane-1-carboxamide.
| Compound Name | N-butan-2-yl-1-cyanocyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 78994718 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | N-butan-2-yl-1-cyanocyclobutane-1-carboxamide |
| SMILES | CCC(C)NC(=O)C1(C#N)CCC1 |
| InChI | InChI=1S/C10H16N2O/c1-3-8(2)12-9(13)10(7-11)5-4-6-10/h8H,3-6H2,1-2H3,(H,12,13) |
| InChIKey | RMVKRRKSLHIEEW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |