C19H25N3O2 — CID 125499832
N-[(2R)-butan-2-yl]-4-cyano-1-(2-phenylacetyl)piperidine-4-carboxamide (PubChem CID 125499832) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-4-cyano-1-(2-phenylacetyl)piperidine-4-carboxamide.
| Compound Name | N-[(2R)-butan-2-yl]-4-cyano-1-(2-phenylacetyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 125499832 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | N-[(2R)-butan-2-yl]-4-cyano-1-(2-phenylacetyl)piperidine-4-carboxamide |
| SMILES | CC[C@@H](C)NC(=O)C1(C#N)CCN(C(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H25N3O2/c1-3-15(2)21-18(24)19(14-20)9-11-22(12-10-19)17(23)13-16-7-5-4-6-8-16/h4-8,15H,3,9-13H2,1-2H3,(H,21,24)/t15-/m1/s1 |
| InChIKey | OQGVUUUHOGCORY-OAHLLOKOSA-N |
| XLogP | 2.28 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |