C16H30N2O2 — CID 78998267
tert-butyl 2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)propanoate (PubChem CID 78998267) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is tert-butyl 2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)propanoate.
| Compound Name | tert-butyl 2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)propanoate |
|---|---|
| PubChem CID | 78998267 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | tert-butyl 2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)propanoate |
| SMILES | CC1CN2CCCCC2CN1C(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H30N2O2/c1-12-10-17-9-7-6-8-14(17)11-18(12)13(2)15(19)20-16(3,4)5/h12-14H,6-11H2,1-5H3 |
| InChIKey | RPRMXLFYRAYIAX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |