C15H29N3O2 — CID 79946066
methyl 2-amino-2-methyl-4-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)pentanoate (PubChem CID 79946066) has the molecular formula C15H29N3O2 and a molecular weight of 283.42 g/mol. Its IUPAC name is methyl 2-amino-2-methyl-4-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)pentanoate.
| Compound Name | methyl 2-amino-2-methyl-4-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)pentanoate |
|---|---|
| PubChem CID | 79946066 |
| Molecular Formula | C15H29N3O2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | methyl 2-amino-2-methyl-4-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)pentanoate |
| SMILES | COC(=O)C(C)(N)CC(C)N1CC2CCCN2CC1C |
| InChI | InChI=1S/C15H29N3O2/c1-11(8-15(3,16)14(19)20-4)18-10-13-6-5-7-17(13)9-12(18)2/h11-13H,5-10,16H2,1-4H3 |
| InChIKey | JQXXCHFHVVBVOJ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |