C16H28N2O2 — CID 78998454
2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-N-(2-methyl-4-oxopentan-3-yl)acetamide (PubChem CID 78998454) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-N-(2-methyl-4-oxopentan-3-yl)acetamide.
| Compound Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-N-(2-methyl-4-oxopentan-3-yl)acetamide |
|---|---|
| PubChem CID | 78998454 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-N-(2-methyl-4-oxopentan-3-yl)acetamide |
| SMILES | CC(=O)C(NC(=O)CN1CCC2CCCCC21)C(C)C |
| InChI | InChI=1S/C16H28N2O2/c1-11(2)16(12(3)19)17-15(20)10-18-9-8-13-6-4-5-7-14(13)18/h11,13-14,16H,4-10H2,1-3H3,(H,17,20) |
| InChIKey | UDACRRPIFOAVQG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |