C11H17NO4 — CID 79000788
(2R,4R)-4-hydroxy-1-(2-methylpent-2-enoyl)pyrrolidine-2-carboxylic acid (PubChem CID 79000788) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is (2R,4R)-4-hydroxy-1-(2-methylpent-2-enoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R,4R)-4-hydroxy-1-(2-methylpent-2-enoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 79000788 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | (2R,4R)-4-hydroxy-1-(2-methylpent-2-enoyl)pyrrolidine-2-carboxylic acid |
| SMILES | CCC=C(C)C(=O)N1C[C@H](O)C[C@@H]1C(=O)O |
| InChI | InChI=1S/C11H17NO4/c1-3-4-7(2)10(14)12-6-8(13)5-9(12)11(15)16/h4,8-9,13H,3,5-6H2,1-2H3,(H,15,16)/t8-,9-/m1/s1 |
| InChIKey | LBODEIFYPYYIIR-RKDXNWHRSA-N |
| XLogP | 0.39 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|