C7H11N3O — CID 79002172
4-propoxypyrimidin-2-amine (PubChem CID 79002172) has the molecular formula C7H11N3O and a molecular weight of 153.19 g/mol. Its IUPAC name is 4-propoxypyrimidin-2-amine.
| Compound Name | 4-propoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 79002172 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 4-propoxypyrimidin-2-amine |
| SMILES | CCCOc1ccnc(N)n1 |
| InChI | InChI=1S/C7H11N3O/c1-2-5-11-6-3-4-9-7(8)10-6/h3-4H,2,5H2,1H3,(H2,8,9,10) |
| InChIKey | WELSYRUGYUVOEJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |