C13H18ClN3O — CID 79005580
4-chloro-N-(1,2-dimethylpiperidin-4-yl)pyridine-2-carboxamide (PubChem CID 79005580) has the molecular formula C13H18ClN3O and a molecular weight of 267.76 g/mol. Its IUPAC name is 4-chloro-N-(1,2-dimethylpiperidin-4-yl)pyridine-2-carboxamide.
| Compound Name | 4-chloro-N-(1,2-dimethylpiperidin-4-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 79005580 |
| Molecular Formula | C13H18ClN3O |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 4-chloro-N-(1,2-dimethylpiperidin-4-yl)pyridine-2-carboxamide |
| SMILES | CC1CC(NC(=O)c2cc(Cl)ccn2)CCN1C |
| InChI | InChI=1S/C13H18ClN3O/c1-9-7-11(4-6-17(9)2)16-13(18)12-8-10(14)3-5-15-12/h3,5,8-9,11H,4,6-7H2,1-2H3,(H,16,18) |
| InChIKey | KLDZFMAYHWLHOC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |