C17H17ClN4O2 — CID 86991925
4-chloro-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]pyridine-2-carboxamide (PubChem CID 86991925) has the molecular formula C17H17ClN4O2 and a molecular weight of 344.80 g/mol. Its IUPAC name is 4-chloro-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]pyridine-2-carboxamide.
| Compound Name | 4-chloro-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 86991925 |
| Molecular Formula | C17H17ClN4O2 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 4-chloro-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]pyridine-2-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)c2ccncc2)CC1)c1cc(Cl)ccn1 |
| InChI | InChI=1S/C17H17ClN4O2/c18-13-3-8-20-15(11-13)16(23)21-14-4-9-22(10-5-14)17(24)12-1-6-19-7-2-12/h1-3,6-8,11,14H,4-5,9-10H2,(H,21,23) |
| InChIKey | GWPKUZFERXZOOI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |