C14H18F3NO2 — CID 79008502
methyl 2-benzyl-2-(2,2,2-trifluoroethylamino)butanoate (PubChem CID 79008502) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is methyl 2-benzyl-2-(2,2,2-trifluoroethylamino)butanoate.
| Compound Name | methyl 2-benzyl-2-(2,2,2-trifluoroethylamino)butanoate |
|---|---|
| PubChem CID | 79008502 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | methyl 2-benzyl-2-(2,2,2-trifluoroethylamino)butanoate |
| SMILES | CCC(Cc1ccccc1)(NCC(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C14H18F3NO2/c1-3-13(12(19)20-2,18-10-14(15,16)17)9-11-7-5-4-6-8-11/h4-8,18H,3,9-10H2,1-2H3 |
| InChIKey | PQJAWPJCJDUETI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |