C15H19ClN2O2 — CID 79025841
(1R)-1-[4-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methoxy]phenyl]ethanol (PubChem CID 79025841) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is (1R)-1-[4-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methoxy]phenyl]ethanol.
| Compound Name | (1R)-1-[4-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methoxy]phenyl]ethanol |
|---|---|
| PubChem CID | 79025841 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | (1R)-1-[4-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methoxy]phenyl]ethanol |
| SMILES | CCc1nn(C)c(COc2ccc([C@@H](C)O)cc2)c1Cl |
| InChI | InChI=1S/C15H19ClN2O2/c1-4-13-15(16)14(18(3)17-13)9-20-12-7-5-11(6-8-12)10(2)19/h5-8,10,19H,4,9H2,1-3H3/t10-/m1/s1 |
| InChIKey | MPSRJZXLXKERHD-SNVBAGLBSA-N |
| XLogP | 3.27 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |