C14H22N2O2 — CID 79032189
4-[[(1,2-dimethylpiperidin-4-yl)amino]methyl]benzene-1,3-diol (PubChem CID 79032189) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 4-[[(1,2-dimethylpiperidin-4-yl)amino]methyl]benzene-1,3-diol.
| Compound Name | 4-[[(1,2-dimethylpiperidin-4-yl)amino]methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 79032189 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 4-[[(1,2-dimethylpiperidin-4-yl)amino]methyl]benzene-1,3-diol |
| SMILES | CC1CC(NCc2ccc(O)cc2O)CCN1C |
| InChI | InChI=1S/C14H22N2O2/c1-10-7-12(5-6-16(10)2)15-9-11-3-4-13(17)8-14(11)18/h3-4,8,10,12,15,17-18H,5-7,9H2,1-2H3 |
| InChIKey | TYANIRKRFNEQRH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|