C14H21ClN2O — CID 79032255
4-chloro-2-[[(1,2-dimethylpiperidin-4-yl)amino]methyl]phenol (PubChem CID 79032255) has the molecular formula C14H21ClN2O and a molecular weight of 268.79 g/mol. Its IUPAC name is 4-chloro-2-[[(1,2-dimethylpiperidin-4-yl)amino]methyl]phenol.
| Compound Name | 4-chloro-2-[[(1,2-dimethylpiperidin-4-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 79032255 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4-chloro-2-[[(1,2-dimethylpiperidin-4-yl)amino]methyl]phenol |
| SMILES | CC1CC(NCc2cc(Cl)ccc2O)CCN1C |
| InChI | InChI=1S/C14H21ClN2O/c1-10-7-13(5-6-17(10)2)16-9-11-8-12(15)3-4-14(11)18/h3-4,8,10,13,16,18H,5-7,9H2,1-2H3 |
| InChIKey | CBBLCKFJKAFMDF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|