About 1-(3,3-dimethylpyrrolidin-1-yl)-2,2,2-trifluoroethanone
1-(3,3-dimethylpyrrolidin-1-yl)-2,2,2-trifluoroethanone (PubChem CID 79036683) has the molecular formula C8H12F3NO
and a molecular weight of 195.18 g/mol. Its IUPAC name is 1-(3,3-dimethylpyrrolidin-1-yl)-2,2,2-trifluoroethanone.
Molecular Properties
| Compound Name | 1-(3,3-dimethylpyrrolidin-1-yl)-2,2,2-trifluoroethanone |
| PubChem CID | 79036683 |
| Molecular Formula | C8H12F3NO |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 1-(3,3-dimethylpyrrolidin-1-yl)-2,2,2-trifluoroethanone |
| SMILES | CC1(C)CCN(C(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C8H12F3NO/c1-7(2)3-4-12(5-7)6(13)8(9,10)11/h3-5H2,1-2H3 |
| InChIKey | OREJOXDQCYPQBR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3,3-dimethylpyrrolidin-1-yl)-2,2,2-trifluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dimethylpyrrolidin-1-yl)-2,2,2-trifluoroethanone?
The IUPAC name of 1-(3,3-dimethylpyrrolidin-1-yl)-2,2,2-trifluoroethanone (CID 79036683) is 1-(3,3-dimethylpyrrolidin-1-yl)-2,2,2-trifluoroethanone.
What is the SMILES notation for 1-(3,3-dimethylpyrrolidin-1-yl)-2,2,2-trifluoroethanone?
The canonical SMILES for 1-(3,3-dimethylpyrrolidin-1-yl)-2,2,2-trifluoroethanone is CC1(C)CCN(C(=O)C(F)(F)F)C1.
What is the InChIKey of 1-(3,3-dimethylpyrrolidin-1-yl)-2,2,2-trifluoroethanone?
The InChIKey is OREJOXDQCYPQBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F3NO/c1-7(2)3-4-12(5-7)6(13)8(9,10)11/h3-5H2,1-2H3.
What are the key properties of 1-(3,3-dimethylpyrrolidin-1-yl)-2,2,2-trifluoroethanone?
1-(3,3-dimethylpyrrolidin-1-yl)-2,2,2-trifluoroethanone has a molecular weight of 195.18 g/mol, XLogP of 1.81, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethylpyrrolidin-1-yl)-2,2,2-trifluoroethanone is sourced from PubChem (CID 79036683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).