C14H23NO2S — CID 79045888
4-methyl-4-morpholin-4-yl-1-thiophen-3-ylpentan-3-ol (PubChem CID 79045888) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is 4-methyl-4-morpholin-4-yl-1-thiophen-3-ylpentan-3-ol.
| Compound Name | 4-methyl-4-morpholin-4-yl-1-thiophen-3-ylpentan-3-ol |
|---|---|
| PubChem CID | 79045888 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 4-methyl-4-morpholin-4-yl-1-thiophen-3-ylpentan-3-ol |
| SMILES | CC(C)(C(O)CCc1ccsc1)N1CCOCC1 |
| InChI | InChI=1S/C14H23NO2S/c1-14(2,15-6-8-17-9-7-15)13(16)4-3-12-5-10-18-11-12/h5,10-11,13,16H,3-4,6-9H2,1-2H3 |
| InChIKey | ZOSIHVSOSUUZQY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |