C11H18N2O5 — CID 79046631
methyl (3S)-1-[2-(methoxycarbonylamino)-2-oxoethyl]piperidine-3-carboxylate (PubChem CID 79046631) has the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. Its IUPAC name is methyl (3S)-1-[2-(methoxycarbonylamino)-2-oxoethyl]piperidine-3-carboxylate.
| Compound Name | methyl (3S)-1-[2-(methoxycarbonylamino)-2-oxoethyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 79046631 |
| Molecular Formula | C11H18N2O5 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | methyl (3S)-1-[2-(methoxycarbonylamino)-2-oxoethyl]piperidine-3-carboxylate |
| SMILES | COC(=O)NC(=O)CN1CCC[C@H](C(=O)OC)C1 |
| InChI | InChI=1S/C11H18N2O5/c1-17-10(15)8-4-3-5-13(6-8)7-9(14)12-11(16)18-2/h8H,3-7H2,1-2H3,(H,12,14,16)/t8-/m0/s1 |
| InChIKey | XWWXHCIKJAYOLB-QMMMGPOBSA-N |
| XLogP | -0.25 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |