C13H18N4O3 — CID 115537541
methyl (3S)-1-[2-oxo-2-(pyrimidin-2-ylamino)ethyl]piperidine-3-carboxylate (PubChem CID 115537541) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is methyl (3S)-1-[2-oxo-2-(pyrimidin-2-ylamino)ethyl]piperidine-3-carboxylate.
| Compound Name | methyl (3S)-1-[2-oxo-2-(pyrimidin-2-ylamino)ethyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 115537541 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | methyl (3S)-1-[2-oxo-2-(pyrimidin-2-ylamino)ethyl]piperidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1CCCN(CC(=O)Nc2ncccn2)C1 |
| InChI | InChI=1S/C13H18N4O3/c1-20-12(19)10-4-2-7-17(8-10)9-11(18)16-13-14-5-3-6-15-13/h3,5-6,10H,2,4,7-9H2,1H3,(H,14,15,16,18)/t10-/m0/s1 |
| InChIKey | JZUAHDDDALTOFP-JTQLQIEISA-N |
| XLogP | 0.30 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |