C15H24FN3O — CID 79051186
N-ethyl-1-(5-fluoro-3-pyridinyl)-2-methyl-2-morpholin-4-ylpropan-1-amine (PubChem CID 79051186) has the molecular formula C15H24FN3O and a molecular weight of 281.37 g/mol. Its IUPAC name is N-ethyl-1-(5-fluoro-3-pyridinyl)-2-methyl-2-morpholin-4-ylpropan-1-amine.
| Compound Name | N-ethyl-1-(5-fluoro-3-pyridinyl)-2-methyl-2-morpholin-4-ylpropan-1-amine |
|---|---|
| PubChem CID | 79051186 |
| Molecular Formula | C15H24FN3O |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | N-ethyl-1-(5-fluoro-3-pyridinyl)-2-methyl-2-morpholin-4-ylpropan-1-amine |
| SMILES | CCNC(c1cncc(F)c1)C(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C15H24FN3O/c1-4-18-14(12-9-13(16)11-17-10-12)15(2,3)19-5-7-20-8-6-19/h9-11,14,18H,4-8H2,1-3H3 |
| InChIKey | MCIRIJPRXWRSGO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |