C16H30N4O — CID 79051327
N-ethyl-2-methyl-2-morpholin-4-yl-1-(1-propylimidazol-2-yl)propan-1-amine (PubChem CID 79051327) has the molecular formula C16H30N4O and a molecular weight of 294.44 g/mol. Its IUPAC name is N-ethyl-2-methyl-2-morpholin-4-yl-1-(1-propylimidazol-2-yl)propan-1-amine.
| Compound Name | N-ethyl-2-methyl-2-morpholin-4-yl-1-(1-propylimidazol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 79051327 |
| Molecular Formula | C16H30N4O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | N-ethyl-2-methyl-2-morpholin-4-yl-1-(1-propylimidazol-2-yl)propan-1-amine |
| SMILES | CCCn1ccnc1C(NCC)C(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C16H30N4O/c1-5-8-19-9-7-18-15(19)14(17-6-2)16(3,4)20-10-12-21-13-11-20/h7,9,14,17H,5-6,8,10-13H2,1-4H3 |
| InChIKey | DTYHYCJPBXWQOG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |