C16H19F2NO — CID 79058928
(2,5-difluorophenyl)-(1-pyrrolidin-1-ylcyclopentyl)methanone (PubChem CID 79058928) has the molecular formula C16H19F2NO and a molecular weight of 279.33 g/mol. Its IUPAC name is (2,5-difluorophenyl)-(1-pyrrolidin-1-ylcyclopentyl)methanone.
| Compound Name | (2,5-difluorophenyl)-(1-pyrrolidin-1-ylcyclopentyl)methanone |
|---|---|
| PubChem CID | 79058928 |
| Molecular Formula | C16H19F2NO |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | (2,5-difluorophenyl)-(1-pyrrolidin-1-ylcyclopentyl)methanone |
| SMILES | O=C(c1cc(F)ccc1F)C1(N2CCCC2)CCCC1 |
| InChI | InChI=1S/C16H19F2NO/c17-12-5-6-14(18)13(11-12)15(20)16(7-1-2-8-16)19-9-3-4-10-19/h5-6,11H,1-4,7-10H2 |
| InChIKey | MHPHJIZYCXOKIM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |