C13H13F2NO2 — CID 82119806
1-(2,5-difluorophenyl)-2-piperidin-1-ylethane-1,2-dione (PubChem CID 82119806) has the molecular formula C13H13F2NO2 and a molecular weight of 253.25 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-2-piperidin-1-ylethane-1,2-dione.
| Compound Name | 1-(2,5-difluorophenyl)-2-piperidin-1-ylethane-1,2-dione |
|---|---|
| PubChem CID | 82119806 |
| Molecular Formula | C13H13F2NO2 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 1-(2,5-difluorophenyl)-2-piperidin-1-ylethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCCCC1)c1cc(F)ccc1F |
| InChI | InChI=1S/C13H13F2NO2/c14-9-4-5-11(15)10(8-9)12(17)13(18)16-6-2-1-3-7-16/h4-5,8H,1-3,6-7H2 |
| InChIKey | WMPBNCCNTOLHRW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|