C12H20F3N3O2 — CID 79082179
N-[(4-methylmorpholin-2-yl)methyl]-3-(trifluoromethyl)pyrrolidine-3-carboxamide (PubChem CID 79082179) has the molecular formula C12H20F3N3O2 and a molecular weight of 295.31 g/mol. Its IUPAC name is N-[(4-methylmorpholin-2-yl)methyl]-3-(trifluoromethyl)pyrrolidine-3-carboxamide.
| Compound Name | N-[(4-methylmorpholin-2-yl)methyl]-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 79082179 |
| Molecular Formula | C12H20F3N3O2 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | N-[(4-methylmorpholin-2-yl)methyl]-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
| SMILES | CN1CCOC(CNC(=O)C2(C(F)(F)F)CCNC2)C1 |
| InChI | InChI=1S/C12H20F3N3O2/c1-18-4-5-20-9(7-18)6-17-10(19)11(12(13,14)15)2-3-16-8-11/h9,16H,2-8H2,1H3,(H,17,19) |
| InChIKey | IGQIVOVEKWGJGN-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |