C12H20F3N3O3 — CID 138022732
3-methoxy-N-[(4-methylmorpholin-2-yl)methyl]-3-(trifluoromethyl)azetidine-1-carboxamide (PubChem CID 138022732) has the molecular formula C12H20F3N3O3 and a molecular weight of 311.30 g/mol. Its IUPAC name is 3-methoxy-N-[(4-methylmorpholin-2-yl)methyl]-3-(trifluoromethyl)azetidine-1-carboxamide.
| Compound Name | 3-methoxy-N-[(4-methylmorpholin-2-yl)methyl]-3-(trifluoromethyl)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 138022732 |
| Molecular Formula | C12H20F3N3O3 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 3-methoxy-N-[(4-methylmorpholin-2-yl)methyl]-3-(trifluoromethyl)azetidine-1-carboxamide |
| SMILES | COC1(C(F)(F)F)CN(C(=O)NCC2CN(C)CCO2)C1 |
| InChI | InChI=1S/C12H20F3N3O3/c1-17-3-4-21-9(6-17)5-16-10(19)18-7-11(8-18,20-2)12(13,14)15/h9H,3-8H2,1-2H3,(H,16,19) |
| InChIKey | YRICZFUIBIANSK-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |