C14H25N3O2 — CID 79082865
N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-aminocyclopentane-1-carboxamide (PubChem CID 79082865) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-aminocyclopentane-1-carboxamide.
| Compound Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-aminocyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 79082865 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-aminocyclopentane-1-carboxamide |
| SMILES | NC1CCC(C(=O)NCC2CN3CCCC3CO2)C1 |
| InChI | InChI=1S/C14H25N3O2/c15-11-4-3-10(6-11)14(18)16-7-13-8-17-5-1-2-12(17)9-19-13/h10-13H,1-9,15H2,(H,16,18) |
| InChIKey | VVZASTAGEPUBLE-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |