C11H12N2O3S — CID 79084857
5-[1-(1-methylpyrazol-4-yl)sulfanylethyl]furan-2-carboxylic acid (PubChem CID 79084857) has the molecular formula C11H12N2O3S and a molecular weight of 252.29 g/mol. Its IUPAC name is 5-[1-(1-methylpyrazol-4-yl)sulfanylethyl]furan-2-carboxylic acid.
| Compound Name | 5-[1-(1-methylpyrazol-4-yl)sulfanylethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 79084857 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 5-[1-(1-methylpyrazol-4-yl)sulfanylethyl]furan-2-carboxylic acid |
| SMILES | CC(Sc1cnn(C)c1)c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C11H12N2O3S/c1-7(17-8-5-12-13(2)6-8)9-3-4-10(16-9)11(14)15/h3-7H,1-2H3,(H,14,15) |
| InChIKey | GNLODJUCYAKPDP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |