C14H14N4O2 — CID 79086319
1-[(1,3-dioxoisoindol-2-yl)methyl]piperazine-2-carbonitrile (PubChem CID 79086319) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 1-[(1,3-dioxoisoindol-2-yl)methyl]piperazine-2-carbonitrile.
| Compound Name | 1-[(1,3-dioxoisoindol-2-yl)methyl]piperazine-2-carbonitrile |
|---|---|
| PubChem CID | 79086319 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 1-[(1,3-dioxoisoindol-2-yl)methyl]piperazine-2-carbonitrile |
| SMILES | N#CC1CNCCN1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H14N4O2/c15-7-10-8-16-5-6-17(10)9-18-13(19)11-3-1-2-4-12(11)14(18)20/h1-4,10,16H,5-6,8-9H2 |
| InChIKey | XRFYDUKPSWDCCQ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|