C13H23N3O — CID 79088196
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(piperidin-1-yl)methanimine (PubChem CID 79088196) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(piperidin-1-yl)methanimine.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(piperidin-1-yl)methanimine |
|---|---|
| PubChem CID | 79088196 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(piperidin-1-yl)methanimine |
| SMILES | [H]/N=C(/C1CN2CCCC2CO1)N1CCCCC1 |
| InChI | InChI=1S/C13H23N3O/c14-13(15-6-2-1-3-7-15)12-9-16-8-4-5-11(16)10-17-12/h11-12,14H,1-10H2/b14-13- |
| InChIKey | QGXRGYLRTQNDPI-YPKPFQOOSA-N |
| XLogP | 1.31 |
| TPSA | 39.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|