C14H25N3 — CID 79090139
N-(2,5-dimethylpyrrol-1-yl)-1-propylpiperidin-4-amine (PubChem CID 79090139) has the molecular formula C14H25N3 and a molecular weight of 235.38 g/mol. Its IUPAC name is N-(2,5-dimethylpyrrol-1-yl)-1-propylpiperidin-4-amine.
| Compound Name | N-(2,5-dimethylpyrrol-1-yl)-1-propylpiperidin-4-amine |
|---|---|
| PubChem CID | 79090139 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.38 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | N-(2,5-dimethylpyrrol-1-yl)-1-propylpiperidin-4-amine |
| SMILES | CCCN1CCC(Nn2c(C)ccc2C)CC1 |
| InChI | InChI=1S/C14H25N3/c1-4-9-16-10-7-14(8-11-16)15-17-12(2)5-6-13(17)3/h5-6,14-15H,4,7-11H2,1-3H3 |
| InChIKey | ARAWCNSZUFQTFS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |