C13H23N5 — CID 80897058
6-hydrazinyl-N-(1-propylpiperidin-4-yl)pyridin-2-amine (PubChem CID 80897058) has the molecular formula C13H23N5 and a molecular weight of 249.36 g/mol. Its IUPAC name is 6-hydrazinyl-N-(1-propylpiperidin-4-yl)pyridin-2-amine.
| Compound Name | 6-hydrazinyl-N-(1-propylpiperidin-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 80897058 |
| Molecular Formula | C13H23N5 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | 6-hydrazinyl-N-(1-propylpiperidin-4-yl)pyridin-2-amine |
| SMILES | CCCN1CCC(Nc2cccc(NN)n2)CC1 |
| InChI | InChI=1S/C13H23N5/c1-2-8-18-9-6-11(7-10-18)15-12-4-3-5-13(16-12)17-14/h3-5,11H,2,6-10,14H2,1H3,(H2,15,16,17) |
| InChIKey | TZSNRLYAJMRKRI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|