C14H25N5 — CID 80807066
2-N-ethyl-4-N-(1-propylpiperidin-4-yl)pyrimidine-2,4-diamine (PubChem CID 80807066) has the molecular formula C14H25N5 and a molecular weight of 263.39 g/mol. Its IUPAC name is 2-N-ethyl-4-N-(1-propylpiperidin-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-ethyl-4-N-(1-propylpiperidin-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80807066 |
| Molecular Formula | C14H25N5 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | 2-N-ethyl-4-N-(1-propylpiperidin-4-yl)pyrimidine-2,4-diamine |
| SMILES | CCCN1CCC(Nc2ccnc(NCC)n2)CC1 |
| InChI | InChI=1S/C14H25N5/c1-3-9-19-10-6-12(7-11-19)17-13-5-8-16-14(18-13)15-4-2/h5,8,12H,3-4,6-7,9-11H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | BNTOUSSIOBSGOR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |