About 6-N,2-diethyl-4-N-(1-propylpiperidin-4-yl)pyrimidine-4,6-diamine
6-N,2-diethyl-4-N-(1-propylpiperidin-4-yl)pyrimidine-4,6-diamine (PubChem CID 80940140) has the molecular formula C16H29N5
and a molecular weight of 291.44 g/mol. Its IUPAC name is 6-N,2-diethyl-4-N-(1-propylpiperidin-4-yl)pyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 6-N,2-diethyl-4-N-(1-propylpiperidin-4-yl)pyrimidine-4,6-diamine |
| PubChem CID | 80940140 |
| Molecular Formula | C16H29N5 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.24 |
| IUPAC Name | 6-N,2-diethyl-4-N-(1-propylpiperidin-4-yl)pyrimidine-4,6-diamine |
| SMILES | CCCN1CCC(Nc2cc(NCC)nc(CC)n2)CC1 |
| InChI | InChI=1S/C16H29N5/c1-4-9-21-10-7-13(8-11-21)18-16-12-15(17-6-3)19-14(5-2)20-16/h12-13H,4-11H2,1-3H3,(H2,17,18,19,20) |
| InChIKey | NRZKAOFJNIPGAE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-N,2-diethyl-4-N-(1-propylpiperidin-4-yl)pyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N,2-diethyl-4-N-(1-propylpiperidin-4-yl)pyrimidine-4,6-diamine?
The IUPAC name of 6-N,2-diethyl-4-N-(1-propylpiperidin-4-yl)pyrimidine-4,6-diamine (CID 80940140) is 6-N,2-diethyl-4-N-(1-propylpiperidin-4-yl)pyrimidine-4,6-diamine.
What is the SMILES notation for 6-N,2-diethyl-4-N-(1-propylpiperidin-4-yl)pyrimidine-4,6-diamine?
The canonical SMILES for 6-N,2-diethyl-4-N-(1-propylpiperidin-4-yl)pyrimidine-4,6-diamine is CCCN1CCC(Nc2cc(NCC)nc(CC)n2)CC1.
What is the InChIKey of 6-N,2-diethyl-4-N-(1-propylpiperidin-4-yl)pyrimidine-4,6-diamine?
The InChIKey is NRZKAOFJNIPGAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29N5/c1-4-9-21-10-7-13(8-11-21)18-16-12-15(17-6-3)19-14(5-2)20-16/h12-13H,4-11H2,1-3H3,(H2,17,18,19,20).
What are the key properties of 6-N,2-diethyl-4-N-(1-propylpiperidin-4-yl)pyrimidine-4,6-diamine?
6-N,2-diethyl-4-N-(1-propylpiperidin-4-yl)pyrimidine-4,6-diamine has a molecular weight of 291.44 g/mol, XLogP of 2.76, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N,2-diethyl-4-N-(1-propylpiperidin-4-yl)pyrimidine-4,6-diamine is sourced from PubChem (CID 80940140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).