C11H14N2OS — CID 79090711
N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]pyrrol-1-amine (PubChem CID 79090711) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]pyrrol-1-amine.
| Compound Name | N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]pyrrol-1-amine |
|---|---|
| PubChem CID | 79090711 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]pyrrol-1-amine |
| SMILES | CSCc1ccc(CNn2cccc2)o1 |
| InChI | InChI=1S/C11H14N2OS/c1-15-9-11-5-4-10(14-11)8-12-13-6-2-3-7-13/h2-7,12H,8-9H2,1H3 |
| InChIKey | DYJHKJWIMKOAOU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 30.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |