C14H19NOS2 — CID 61057757
N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]-1-thiophen-2-ylpropan-1-amine (PubChem CID 61057757) has the molecular formula C14H19NOS2 and a molecular weight of 281.45 g/mol. Its IUPAC name is N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]-1-thiophen-2-ylpropan-1-amine.
| Compound Name | N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]-1-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 61057757 |
| Molecular Formula | C14H19NOS2 |
| Molecular Weight | 281.45 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]-1-thiophen-2-ylpropan-1-amine |
| SMILES | CCC(NCc1ccc(CSC)o1)c1cccs1 |
| InChI | InChI=1S/C14H19NOS2/c1-3-13(14-5-4-8-18-14)15-9-11-6-7-12(16-11)10-17-2/h4-8,13,15H,3,9-10H2,1-2H3 |
| InChIKey | HAOWYBMSHNQCFD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |