C15H23N5O — CID 79095539
7-(2-amino-1-pyridin-2-ylbutyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 79095539) has the molecular formula C15H23N5O and a molecular weight of 289.38 g/mol. Its IUPAC name is 7-(2-amino-1-pyridin-2-ylbutyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 7-(2-amino-1-pyridin-2-ylbutyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 79095539 |
| Molecular Formula | C15H23N5O |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 7-(2-amino-1-pyridin-2-ylbutyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | CCC(N)C(c1ccccn1)N1CCN2C(=O)NCC2C1 |
| InChI | InChI=1S/C15H23N5O/c1-2-12(16)14(13-5-3-4-6-17-13)19-7-8-20-11(10-19)9-18-15(20)21/h3-6,11-12,14H,2,7-10,16H2,1H3,(H,18,21) |
| InChIKey | PKTKVAKBNPGPQN-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |