C16H28N4 — CID 63604175
1-pyridin-2-yl-1-(3,3,4-trimethylpiperazin-1-yl)butan-2-amine (PubChem CID 63604175) has the molecular formula C16H28N4 and a molecular weight of 276.43 g/mol. Its IUPAC name is 1-pyridin-2-yl-1-(3,3,4-trimethylpiperazin-1-yl)butan-2-amine.
| Compound Name | 1-pyridin-2-yl-1-(3,3,4-trimethylpiperazin-1-yl)butan-2-amine |
|---|---|
| PubChem CID | 63604175 |
| Molecular Formula | C16H28N4 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | 1-pyridin-2-yl-1-(3,3,4-trimethylpiperazin-1-yl)butan-2-amine |
| SMILES | CCC(N)C(c1ccccn1)N1CCN(C)C(C)(C)C1 |
| InChI | InChI=1S/C16H28N4/c1-5-13(17)15(14-8-6-7-9-18-14)20-11-10-19(4)16(2,3)12-20/h6-9,13,15H,5,10-12,17H2,1-4H3 |
| InChIKey | KSOKNHVRXLBRTC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |