C13H24N2O — CID 79098074
N-ethyl-1-[1-(2-methoxyethyl)pyrrol-3-yl]-2-methylpropan-1-amine (PubChem CID 79098074) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is N-ethyl-1-[1-(2-methoxyethyl)pyrrol-3-yl]-2-methylpropan-1-amine.
| Compound Name | N-ethyl-1-[1-(2-methoxyethyl)pyrrol-3-yl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 79098074 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | N-ethyl-1-[1-(2-methoxyethyl)pyrrol-3-yl]-2-methylpropan-1-amine |
| SMILES | CCNC(c1ccn(CCOC)c1)C(C)C |
| InChI | InChI=1S/C13H24N2O/c1-5-14-13(11(2)3)12-6-7-15(10-12)8-9-16-4/h6-7,10-11,13-14H,5,8-9H2,1-4H3 |
| InChIKey | PVQAUAZNDHAJHU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |