C16H28N2 — CID 79097227
1-[1-(cyclopentylmethyl)pyrrol-3-yl]-N-ethyl-2-methylpropan-1-amine (PubChem CID 79097227) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 1-[1-(cyclopentylmethyl)pyrrol-3-yl]-N-ethyl-2-methylpropan-1-amine.
| Compound Name | 1-[1-(cyclopentylmethyl)pyrrol-3-yl]-N-ethyl-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 79097227 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 1-[1-(cyclopentylmethyl)pyrrol-3-yl]-N-ethyl-2-methylpropan-1-amine |
| SMILES | CCNC(c1ccn(CC2CCCC2)c1)C(C)C |
| InChI | InChI=1S/C16H28N2/c1-4-17-16(13(2)3)15-9-10-18(12-15)11-14-7-5-6-8-14/h9-10,12-14,16-17H,4-8,11H2,1-3H3 |
| InChIKey | OGFRTEMLVXKVQH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |