C17H23FN2 — CID 79097640
N-ethyl-1-[1-[(3-fluorophenyl)methyl]pyrrol-3-yl]-2-methylpropan-1-amine (PubChem CID 79097640) has the molecular formula C17H23FN2 and a molecular weight of 274.38 g/mol. Its IUPAC name is N-ethyl-1-[1-[(3-fluorophenyl)methyl]pyrrol-3-yl]-2-methylpropan-1-amine.
| Compound Name | N-ethyl-1-[1-[(3-fluorophenyl)methyl]pyrrol-3-yl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 79097640 |
| Molecular Formula | C17H23FN2 |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | N-ethyl-1-[1-[(3-fluorophenyl)methyl]pyrrol-3-yl]-2-methylpropan-1-amine |
| SMILES | CCNC(c1ccn(Cc2cccc(F)c2)c1)C(C)C |
| InChI | InChI=1S/C17H23FN2/c1-4-19-17(13(2)3)15-8-9-20(12-15)11-14-6-5-7-16(18)10-14/h5-10,12-13,17,19H,4,11H2,1-3H3 |
| InChIKey | YBJXDYBUDARVHM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |