C17H22ClFN2 — CID 79108322
1-[1-[(2-chloro-4-fluorophenyl)methyl]pyrrol-3-yl]-N-ethyl-2-methylpropan-1-amine (PubChem CID 79108322) has the molecular formula C17H22ClFN2 and a molecular weight of 308.83 g/mol. Its IUPAC name is 1-[1-[(2-chloro-4-fluorophenyl)methyl]pyrrol-3-yl]-N-ethyl-2-methylpropan-1-amine.
| Compound Name | 1-[1-[(2-chloro-4-fluorophenyl)methyl]pyrrol-3-yl]-N-ethyl-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 79108322 |
| Molecular Formula | C17H22ClFN2 |
| Molecular Weight | 308.83 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 1-[1-[(2-chloro-4-fluorophenyl)methyl]pyrrol-3-yl]-N-ethyl-2-methylpropan-1-amine |
| SMILES | CCNC(c1ccn(Cc2ccc(F)cc2Cl)c1)C(C)C |
| InChI | InChI=1S/C17H22ClFN2/c1-4-20-17(12(2)3)14-7-8-21(11-14)10-13-5-6-15(19)9-16(13)18/h5-9,11-12,17,20H,4,10H2,1-3H3 |
| InChIKey | RBARZYMSEZUCAA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.83 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |