C11H17BrN2O — CID 79101127
2-bromo-N-(2,5-dimethylpyrrol-1-yl)-3-methylbutanamide (PubChem CID 79101127) has the molecular formula C11H17BrN2O and a molecular weight of 273.17 g/mol. Its IUPAC name is 2-bromo-N-(2,5-dimethylpyrrol-1-yl)-3-methylbutanamide.
| Compound Name | 2-bromo-N-(2,5-dimethylpyrrol-1-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 79101127 |
| Molecular Formula | C11H17BrN2O |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 2-bromo-N-(2,5-dimethylpyrrol-1-yl)-3-methylbutanamide |
| SMILES | Cc1ccc(C)n1NC(=O)C(Br)C(C)C |
| InChI | InChI=1S/C11H17BrN2O/c1-7(2)10(12)11(15)13-14-8(3)5-6-9(14)4/h5-7,10H,1-4H3,(H,13,15) |
| InChIKey | NODBMURYCAEXHY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|